C16H15Br2NO2 — CID 60782030
3-[1-(2,4-dibromophenyl)ethylamino]-2-methylbenzoic acid (PubChem CID 60782030) has the molecular formula C16H15Br2NO2 and a molecular weight of 413.11 g/mol. Its IUPAC name is 3-[1-(2,4-dibromophenyl)ethylamino]-2-methylbenzoic acid.
| Compound Name | 3-[1-(2,4-dibromophenyl)ethylamino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 60782030 |
| Molecular Formula | C16H15Br2NO2 |
| Molecular Weight | 413.11 g/mol |
| Exact Mass | 410.95 |
| IUPAC Name | 3-[1-(2,4-dibromophenyl)ethylamino]-2-methylbenzoic acid |
| SMILES | Cc1c(NC(C)c2ccc(Br)cc2Br)cccc1C(=O)O |
| InChI | InChI=1S/C16H15Br2NO2/c1-9-12(16(20)21)4-3-5-15(9)19-10(2)13-7-6-11(17)8-14(13)18/h3-8,10,19H,1-2H3,(H,20,21) |
| InChIKey | KSHZSGIOYBBXGB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.11 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |