C14H18BrN3 — CID 60784120
5-bromo-1-ethyl-2-piperidin-2-ylbenzimidazole (PubChem CID 60784120) has the molecular formula C14H18BrN3 and a molecular weight of 308.22 g/mol. Its IUPAC name is 5-bromo-1-ethyl-2-piperidin-2-ylbenzimidazole.
| Compound Name | 5-bromo-1-ethyl-2-piperidin-2-ylbenzimidazole |
|---|---|
| PubChem CID | 60784120 |
| Molecular Formula | C14H18BrN3 |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 5-bromo-1-ethyl-2-piperidin-2-ylbenzimidazole |
| SMILES | CCn1c(C2CCCCN2)nc2cc(Br)ccc21 |
| InChI | InChI=1S/C14H18BrN3/c1-2-18-13-7-6-10(15)9-12(13)17-14(18)11-5-3-4-8-16-11/h6-7,9,11,16H,2-5,8H2,1H3 |
| InChIKey | YHNCLQKYRXQMMA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |