C14H16F3N3 — CID 62388125
2-piperidin-2-yl-1-(2,2,2-trifluoroethyl)benzimidazole (PubChem CID 62388125) has the molecular formula C14H16F3N3 and a molecular weight of 283.30 g/mol. Its IUPAC name is 2-piperidin-2-yl-1-(2,2,2-trifluoroethyl)benzimidazole.
| Compound Name | 2-piperidin-2-yl-1-(2,2,2-trifluoroethyl)benzimidazole |
|---|---|
| PubChem CID | 62388125 |
| Molecular Formula | C14H16F3N3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-piperidin-2-yl-1-(2,2,2-trifluoroethyl)benzimidazole |
| SMILES | FC(F)(F)Cn1c(C2CCCCN2)nc2ccccc21 |
| InChI | InChI=1S/C14H16F3N3/c15-14(16,17)9-20-12-7-2-1-5-10(12)19-13(20)11-6-3-4-8-18-11/h1-2,5,7,11,18H,3-4,6,8-9H2 |
| InChIKey | AXHKOECEMNLEHU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |