C14H18BrN3O2S — CID 60784180
3-[(5-bromo-1,3-thiazol-2-yl)amino]-1-cycloheptylpyrrolidine-2,5-dione (PubChem CID 60784180) has the molecular formula C14H18BrN3O2S and a molecular weight of 372.29 g/mol. Its IUPAC name is 3-[(5-bromo-1,3-thiazol-2-yl)amino]-1-cycloheptylpyrrolidine-2,5-dione.
| Compound Name | 3-[(5-bromo-1,3-thiazol-2-yl)amino]-1-cycloheptylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 60784180 |
| Molecular Formula | C14H18BrN3O2S |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 3-[(5-bromo-1,3-thiazol-2-yl)amino]-1-cycloheptylpyrrolidine-2,5-dione |
| SMILES | O=C1CC(Nc2ncc(Br)s2)C(=O)N1C1CCCCCC1 |
| InChI | InChI=1S/C14H18BrN3O2S/c15-11-8-16-14(21-11)17-10-7-12(19)18(13(10)20)9-5-3-1-2-4-6-9/h8-10H,1-7H2,(H,16,17) |
| InChIKey | GYUGSKMCLHDVCL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|