About N-(5-bromo-1,3-thiazol-2-yl)morpholine-4-sulfonamide
N-(5-bromo-1,3-thiazol-2-yl)morpholine-4-sulfonamide (PubChem CID 60784975) has the molecular formula C7H10BrN3O3S2
and a molecular weight of 328.21 g/mol. Its IUPAC name is N-(5-bromo-1,3-thiazol-2-yl)morpholine-4-sulfonamide.
Molecular Properties
| Compound Name | N-(5-bromo-1,3-thiazol-2-yl)morpholine-4-sulfonamide |
| PubChem CID | 60784975 |
| Molecular Formula | C7H10BrN3O3S2 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 326.93 |
| IUPAC Name | N-(5-bromo-1,3-thiazol-2-yl)morpholine-4-sulfonamide |
| SMILES | O=S(=O)(Nc1ncc(Br)s1)N1CCOCC1 |
| InChI | InChI=1S/C7H10BrN3O3S2/c8-6-5-9-7(15-6)10-16(12,13)11-1-3-14-4-2-11/h5H,1-4H2,(H,9,10) |
| InChIKey | COEFAPDGDBETRE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-bromo-1,3-thiazol-2-yl)morpholine-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-1,3-thiazol-2-yl)morpholine-4-sulfonamide?
The IUPAC name of N-(5-bromo-1,3-thiazol-2-yl)morpholine-4-sulfonamide (CID 60784975) is N-(5-bromo-1,3-thiazol-2-yl)morpholine-4-sulfonamide.
What is the SMILES notation for N-(5-bromo-1,3-thiazol-2-yl)morpholine-4-sulfonamide?
The canonical SMILES for N-(5-bromo-1,3-thiazol-2-yl)morpholine-4-sulfonamide is O=S(=O)(Nc1ncc(Br)s1)N1CCOCC1.
What is the InChIKey of N-(5-bromo-1,3-thiazol-2-yl)morpholine-4-sulfonamide?
The InChIKey is COEFAPDGDBETRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BrN3O3S2/c8-6-5-9-7(15-6)10-16(12,13)11-1-3-14-4-2-11/h5H,1-4H2,(H,9,10).
What are the key properties of N-(5-bromo-1,3-thiazol-2-yl)morpholine-4-sulfonamide?
N-(5-bromo-1,3-thiazol-2-yl)morpholine-4-sulfonamide has a molecular weight of 328.21 g/mol, XLogP of 0.89, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-1,3-thiazol-2-yl)morpholine-4-sulfonamide is sourced from PubChem (CID 60784975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).