C14H17Cl2N — CID 60788913
1,1-dicyclopropyl-N-[(3,5-dichlorophenyl)methyl]methanamine (PubChem CID 60788913) has the molecular formula C14H17Cl2N and a molecular weight of 270.20 g/mol. Its IUPAC name is 1,1-dicyclopropyl-N-[(3,5-dichlorophenyl)methyl]methanamine.
| Compound Name | 1,1-dicyclopropyl-N-[(3,5-dichlorophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 60788913 |
| Molecular Formula | C14H17Cl2N |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 1,1-dicyclopropyl-N-[(3,5-dichlorophenyl)methyl]methanamine |
| SMILES | Clc1cc(Cl)cc(CNC(C2CC2)C2CC2)c1 |
| InChI | InChI=1S/C14H17Cl2N/c15-12-5-9(6-13(16)7-12)8-17-14(10-1-2-10)11-3-4-11/h5-7,10-11,14,17H,1-4,8H2 |
| InChIKey | HLJGDKHNVXVUEO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |