C12H13FN2O3S — CID 60789741
2-[4-fluoro-1-(2-methoxyethyl)benzimidazol-2-yl]sulfanylacetic acid (PubChem CID 60789741) has the molecular formula C12H13FN2O3S and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-[4-fluoro-1-(2-methoxyethyl)benzimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[4-fluoro-1-(2-methoxyethyl)benzimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 60789741 |
| Molecular Formula | C12H13FN2O3S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 2-[4-fluoro-1-(2-methoxyethyl)benzimidazol-2-yl]sulfanylacetic acid |
| SMILES | COCCn1c(SCC(=O)O)nc2c(F)cccc21 |
| InChI | InChI=1S/C12H13FN2O3S/c1-18-6-5-15-9-4-2-3-8(13)11(9)14-12(15)19-7-10(16)17/h2-4H,5-7H2,1H3,(H,16,17) |
| InChIKey | QCCCCBNDJWARRO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |