C15H15BrN4S — CID 60792931
4-bromo-11-(2-phenylethyl)-5-thia-2,3,7,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,6-triene (PubChem CID 60792931) has the molecular formula C15H15BrN4S and a molecular weight of 363.28 g/mol. Its IUPAC name is 4-bromo-11-(2-phenylethyl)-5-thia-2,3,7,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,6-triene.
| Compound Name | 4-bromo-11-(2-phenylethyl)-5-thia-2,3,7,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,6-triene |
|---|---|
| PubChem CID | 60792931 |
| Molecular Formula | C15H15BrN4S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 4-bromo-11-(2-phenylethyl)-5-thia-2,3,7,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,6-triene |
| SMILES | Brc1nn2c3c(nc2s1)CCN(CCc1ccccc1)C3 |
| InChI | InChI=1S/C15H15BrN4S/c16-14-18-20-13-10-19(8-6-11-4-2-1-3-5-11)9-7-12(13)17-15(20)21-14/h1-5H,6-10H2 |
| InChIKey | JQTPEAAZOQRNMB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |