C15H12N2O3S — CID 60802028
N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 60802028) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 60802028 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1ncc(C#CCO)s1)C1Cc2ccccc2O1 |
| InChI | InChI=1S/C15H12N2O3S/c18-7-3-5-11-9-16-15(21-11)17-14(19)13-8-10-4-1-2-6-12(10)20-13/h1-2,4,6,9,13,18H,7-8H2,(H,16,17,19) |
| InChIKey | OOHYEVZYGIPKMW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|