About [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] acetate
[(E)-1-(1,3-thiazol-2-yl)ethylideneamino] acetate (PubChem CID 6080248) has the molecular formula C7H8N2O2S
and a molecular weight of 184.22 g/mol. Its IUPAC name is [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] acetate.
Molecular Properties
| Compound Name | [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] acetate |
| PubChem CID | 6080248 |
| Molecular Formula | C7H8N2O2S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] acetate |
| SMILES | CC(=O)O/N=C(\C)c1nccs1 |
| InChI | InChI=1S/C7H8N2O2S/c1-5(9-11-6(2)10)7-8-3-4-12-7/h3-4H,1-2H3/b9-5+ |
| InChIKey | ASUHRTXLUOGIRA-WEVVVXLNSA-N |
| XLogP | 1.43 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] acetate?
The IUPAC name of [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] acetate (CID 6080248) is [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] acetate.
What is the SMILES notation for [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] acetate?
The canonical SMILES for [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] acetate is CC(=O)O/N=C(\C)c1nccs1.
What is the InChIKey of [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] acetate?
The InChIKey is ASUHRTXLUOGIRA-WEVVVXLNSA-N. The full InChI is InChI=1S/C7H8N2O2S/c1-5(9-11-6(2)10)7-8-3-4-12-7/h3-4H,1-2H3/b9-5+.
What are the key properties of [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] acetate?
[(E)-1-(1,3-thiazol-2-yl)ethylideneamino] acetate has a molecular weight of 184.22 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-(1,3-thiazol-2-yl)ethylideneamino] acetate is sourced from PubChem (CID 6080248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).