C14H11NO3 — CID 60803102
N-[4-(3-hydroxyprop-1-ynyl)phenyl]furan-2-carboxamide (PubChem CID 60803102) has the molecular formula C14H11NO3 and a molecular weight of 241.25 g/mol. Its IUPAC name is N-[4-(3-hydroxyprop-1-ynyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-(3-hydroxyprop-1-ynyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 60803102 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | N-[4-(3-hydroxyprop-1-ynyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(C#CCO)cc1)c1ccco1 |
| InChI | InChI=1S/C14H11NO3/c16-9-1-3-11-5-7-12(8-6-11)15-14(17)13-4-2-10-18-13/h2,4-8,10,16H,9H2,(H,15,17) |
| InChIKey | CHKCSLZURSFLRP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|