C14H15N5O2 — CID 60803551
N-[6-(4-hydroxybut-1-ynyl)-2-pyridinyl]-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 60803551) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is N-[6-(4-hydroxybut-1-ynyl)-2-pyridinyl]-2-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-[6-(4-hydroxybut-1-ynyl)-2-pyridinyl]-2-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 60803551 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-[6-(4-hydroxybut-1-ynyl)-2-pyridinyl]-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CC(C(=O)Nc1cccc(C#CCCO)n1)n1cncn1 |
| InChI | InChI=1S/C14H15N5O2/c1-11(19-10-15-9-16-19)14(21)18-13-7-4-6-12(17-13)5-2-3-8-20/h4,6-7,9-11,20H,3,8H2,1H3,(H,17,18,21) |
| InChIKey | WBKQAXYSVUPJDP-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|