C15H22Cl2N2O — CID 60807480
N-[2-(2,4-dichlorophenoxy)ethyl]-N-ethylpiperidin-4-amine (PubChem CID 60807480) has the molecular formula C15H22Cl2N2O and a molecular weight of 317.26 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenoxy)ethyl]-N-ethylpiperidin-4-amine.
| Compound Name | N-[2-(2,4-dichlorophenoxy)ethyl]-N-ethylpiperidin-4-amine |
|---|---|
| PubChem CID | 60807480 |
| Molecular Formula | C15H22Cl2N2O |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N-[2-(2,4-dichlorophenoxy)ethyl]-N-ethylpiperidin-4-amine |
| SMILES | CCN(CCOc1ccc(Cl)cc1Cl)C1CCNCC1 |
| InChI | InChI=1S/C15H22Cl2N2O/c1-2-19(13-5-7-18-8-6-13)9-10-20-15-4-3-12(16)11-14(15)17/h3-4,11,13,18H,2,5-10H2,1H3 |
| InChIKey | DWGYMJHXZAHCSH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |