C13H18N4O3S — CID 60808107
3-amino-1-ethyl-N-[(2-methoxyphenyl)methyl]pyrazole-4-sulfonamide (PubChem CID 60808107) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 3-amino-1-ethyl-N-[(2-methoxyphenyl)methyl]pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1-ethyl-N-[(2-methoxyphenyl)methyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60808107 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 3-amino-1-ethyl-N-[(2-methoxyphenyl)methyl]pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCc2ccccc2OC)c(N)n1 |
| InChI | InChI=1S/C13H18N4O3S/c1-3-17-9-12(13(14)16-17)21(18,19)15-8-10-6-4-5-7-11(10)20-2/h4-7,9,15H,3,8H2,1-2H3,(H2,14,16) |
| InChIKey | LTIAAPUXENLXCP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |