C11H13FN4O2S — CID 60808924
5-amino-N-[2-(4-fluorophenyl)ethyl]-1H-pyrazole-4-sulfonamide (PubChem CID 60808924) has the molecular formula C11H13FN4O2S and a molecular weight of 284.32 g/mol. Its IUPAC name is 5-amino-N-[2-(4-fluorophenyl)ethyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-[2-(4-fluorophenyl)ethyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60808924 |
| Molecular Formula | C11H13FN4O2S |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 5-amino-N-[2-(4-fluorophenyl)ethyl]-1H-pyrazole-4-sulfonamide |
| SMILES | Nc1[nH]ncc1S(=O)(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C11H13FN4O2S/c12-9-3-1-8(2-4-9)5-6-15-19(17,18)10-7-14-16-11(10)13/h1-4,7,15H,5-6H2,(H3,13,14,16) |
| InChIKey | GEVBXLSRLZPVEO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |