C6H13N5O4S2 — CID 114174781
5-amino-N-[2-(methylsulfamoyl)ethyl]-1H-pyrazole-4-sulfonamide (PubChem CID 114174781) has the molecular formula C6H13N5O4S2 and a molecular weight of 283.34 g/mol. Its IUPAC name is 5-amino-N-[2-(methylsulfamoyl)ethyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-[2-(methylsulfamoyl)ethyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 114174781 |
| Molecular Formula | C6H13N5O4S2 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 5-amino-N-[2-(methylsulfamoyl)ethyl]-1H-pyrazole-4-sulfonamide |
| SMILES | CNS(=O)(=O)CCNS(=O)(=O)c1cn[nH]c1N |
| InChI | InChI=1S/C6H13N5O4S2/c1-8-16(12,13)3-2-10-17(14,15)5-4-9-11-6(5)7/h4,8,10H,2-3H2,1H3,(H3,7,9,11) |
| InChIKey | OMAJHIGMPNNYAA-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 147.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |