C9H18N4O3S — CID 65102925
5-amino-N-(2-ethyl-2-hydroxybutyl)-1H-pyrazole-4-sulfonamide (PubChem CID 65102925) has the molecular formula C9H18N4O3S and a molecular weight of 262.33 g/mol. Its IUPAC name is 5-amino-N-(2-ethyl-2-hydroxybutyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-(2-ethyl-2-hydroxybutyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 65102925 |
| Molecular Formula | C9H18N4O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 5-amino-N-(2-ethyl-2-hydroxybutyl)-1H-pyrazole-4-sulfonamide |
| SMILES | CCC(O)(CC)CNS(=O)(=O)c1cn[nH]c1N |
| InChI | InChI=1S/C9H18N4O3S/c1-3-9(14,4-2)6-12-17(15,16)7-5-11-13-8(7)10/h5,12,14H,3-4,6H2,1-2H3,(H3,10,11,13) |
| InChIKey | RRKXDXIVDHGNLV-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |