C11H16N4O4 — CID 60809333
6-[(1-methylpyrazol-3-yl)carbamoylamino]-6-oxohexanoic acid (PubChem CID 60809333) has the molecular formula C11H16N4O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 6-[(1-methylpyrazol-3-yl)carbamoylamino]-6-oxohexanoic acid.
| Compound Name | 6-[(1-methylpyrazol-3-yl)carbamoylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 60809333 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 6-[(1-methylpyrazol-3-yl)carbamoylamino]-6-oxohexanoic acid |
| SMILES | Cn1ccc(NC(=O)NC(=O)CCCCC(=O)O)n1 |
| InChI | InChI=1S/C11H16N4O4/c1-15-7-6-8(14-15)12-11(19)13-9(16)4-2-3-5-10(17)18/h6-7H,2-5H2,1H3,(H,17,18)(H2,12,13,14,16,19) |
| InChIKey | CLBQOEXQFUJFID-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|