About 1,3-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]pyrazolo[5,4-b]pyridin-5-amine
1,3-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]pyrazolo[5,4-b]pyridin-5-amine (PubChem CID 60811426) has the molecular formula C13H13N5O2S
and a molecular weight of 303.35 g/mol. Its IUPAC name is 1,3-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]pyrazolo[5,4-b]pyridin-5-amine.
Molecular Properties
| Compound Name | 1,3-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]pyrazolo[5,4-b]pyridin-5-amine |
| PubChem CID | 60811426 |
| Molecular Formula | C13H13N5O2S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 1,3-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]pyrazolo[5,4-b]pyridin-5-amine |
| SMILES | Cc1nn(C)c2ncc(NCc3csc([N+](=O)[O-])c3)cc12 |
| InChI | InChI=1S/C13H13N5O2S/c1-8-11-4-10(6-15-13(11)17(2)16-8)14-5-9-3-12(18(19)20)21-7-9/h3-4,6-7,14H,5H2,1-2H3 |
| InChIKey | QLUTYFNCEPJUHX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]pyrazolo[5,4-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]pyrazolo[5,4-b]pyridin-5-amine?
The IUPAC name of 1,3-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]pyrazolo[5,4-b]pyridin-5-amine (CID 60811426) is 1,3-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]pyrazolo[5,4-b]pyridin-5-amine.
What is the SMILES notation for 1,3-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]pyrazolo[5,4-b]pyridin-5-amine?
The canonical SMILES for 1,3-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]pyrazolo[5,4-b]pyridin-5-amine is Cc1nn(C)c2ncc(NCc3csc([N+](=O)[O-])c3)cc12.
What is the InChIKey of 1,3-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]pyrazolo[5,4-b]pyridin-5-amine?
The InChIKey is QLUTYFNCEPJUHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N5O2S/c1-8-11-4-10(6-15-13(11)17(2)16-8)14-5-9-3-12(18(19)20)21-7-9/h3-4,6-7,14H,5H2,1-2H3.
What are the key properties of 1,3-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]pyrazolo[5,4-b]pyridin-5-amine?
1,3-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]pyrazolo[5,4-b]pyridin-5-amine has a molecular weight of 303.35 g/mol, XLogP of 2.86, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-N-[(5-nitrothiophen-3-yl)methyl]pyrazolo[5,4-b]pyridin-5-amine is sourced from PubChem (CID 60811426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).