C12H15N5O2S — CID 60811832
1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-N-[(5-nitrothiophen-3-yl)methyl]ethanamine (PubChem CID 60811832) has the molecular formula C12H15N5O2S and a molecular weight of 293.35 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-N-[(5-nitrothiophen-3-yl)methyl]ethanamine.
| Compound Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-N-[(5-nitrothiophen-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 60811832 |
| Molecular Formula | C12H15N5O2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)-N-[(5-nitrothiophen-3-yl)methyl]ethanamine |
| SMILES | CC(NCc1csc([N+](=O)[O-])c1)c1nnc2n1CCC2 |
| InChI | InChI=1S/C12H15N5O2S/c1-8(12-15-14-10-3-2-4-16(10)12)13-6-9-5-11(17(18)19)20-7-9/h5,7-8,13H,2-4,6H2,1H3 |
| InChIKey | GZZQFJCIYSAYEU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|