C13H17BrN4S — CID 75422445
N-[(4-bromothiophen-2-yl)methyl]-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine (PubChem CID 75422445) has the molecular formula C13H17BrN4S and a molecular weight of 341.28 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine |
|---|---|
| PubChem CID | 75422445 |
| Molecular Formula | C13H17BrN4S |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine |
| SMILES | CC(NCc1cc(Br)cs1)c1nnc2n1CCCC2 |
| InChI | InChI=1S/C13H17BrN4S/c1-9(15-7-11-6-10(14)8-19-11)13-17-16-12-4-2-3-5-18(12)13/h6,8-9,15H,2-5,7H2,1H3 |
| InChIKey | SXBDUHBTISGUMV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |