C17H19NO3 — CID 60813007
1-[4-(4-hydroxybut-1-ynyl)-3-methylphenyl]azepane-2,7-dione (PubChem CID 60813007) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 1-[4-(4-hydroxybut-1-ynyl)-3-methylphenyl]azepane-2,7-dione.
| Compound Name | 1-[4-(4-hydroxybut-1-ynyl)-3-methylphenyl]azepane-2,7-dione |
|---|---|
| PubChem CID | 60813007 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 1-[4-(4-hydroxybut-1-ynyl)-3-methylphenyl]azepane-2,7-dione |
| SMILES | Cc1cc(N2C(=O)CCCCC2=O)ccc1C#CCCO |
| InChI | InChI=1S/C17H19NO3/c1-13-12-15(10-9-14(13)6-4-5-11-19)18-16(20)7-2-3-8-17(18)21/h9-10,12,19H,2-3,5,7-8,11H2,1H3 |
| InChIKey | KFADTKWLTANAEN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|