C14H12N4O — CID 60814077
N-[6-(3-aminoprop-1-ynyl)-2-pyridinyl]pyridine-2-carboxamide (PubChem CID 60814077) has the molecular formula C14H12N4O and a molecular weight of 252.28 g/mol. Its IUPAC name is N-[6-(3-aminoprop-1-ynyl)-2-pyridinyl]pyridine-2-carboxamide.
| Compound Name | N-[6-(3-aminoprop-1-ynyl)-2-pyridinyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 60814077 |
| Molecular Formula | C14H12N4O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | N-[6-(3-aminoprop-1-ynyl)-2-pyridinyl]pyridine-2-carboxamide |
| SMILES | NCC#Cc1cccc(NC(=O)c2ccccn2)n1 |
| InChI | InChI=1S/C14H12N4O/c15-9-4-6-11-5-3-8-13(17-11)18-14(19)12-7-1-2-10-16-12/h1-3,5,7-8,10H,9,15H2,(H,17,18,19) |
| InChIKey | YPYQZXXIYFCGDF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|