C15H14N4O2 — CID 62874149
N-[6-(3-aminoprop-1-ynyl)-2-pyridinyl]-2-methoxypyridine-3-carboxamide (PubChem CID 62874149) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is N-[6-(3-aminoprop-1-ynyl)-2-pyridinyl]-2-methoxypyridine-3-carboxamide.
| Compound Name | N-[6-(3-aminoprop-1-ynyl)-2-pyridinyl]-2-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 62874149 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | N-[6-(3-aminoprop-1-ynyl)-2-pyridinyl]-2-methoxypyridine-3-carboxamide |
| SMILES | COc1ncccc1C(=O)Nc1cccc(C#CCN)n1 |
| InChI | InChI=1S/C15H14N4O2/c1-21-15-12(7-4-10-17-15)14(20)19-13-8-2-5-11(18-13)6-3-9-16/h2,4-5,7-8,10H,9,16H2,1H3,(H,18,19,20) |
| InChIKey | KQUUZTRIPSHOIZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|