C15H12FN3O2 — CID 115299483
N-[6-(3-aminoprop-1-ynyl)-2-pyridinyl]-5-fluoro-2-hydroxybenzamide (PubChem CID 115299483) has the molecular formula C15H12FN3O2 and a molecular weight of 285.28 g/mol. Its IUPAC name is N-[6-(3-aminoprop-1-ynyl)-2-pyridinyl]-5-fluoro-2-hydroxybenzamide.
| Compound Name | N-[6-(3-aminoprop-1-ynyl)-2-pyridinyl]-5-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 115299483 |
| Molecular Formula | C15H12FN3O2 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-[6-(3-aminoprop-1-ynyl)-2-pyridinyl]-5-fluoro-2-hydroxybenzamide |
| SMILES | NCC#Cc1cccc(NC(=O)c2cc(F)ccc2O)n1 |
| InChI | InChI=1S/C15H12FN3O2/c16-10-6-7-13(20)12(9-10)15(21)19-14-5-1-3-11(18-14)4-2-8-17/h1,3,5-7,9,20H,8,17H2,(H,18,19,21) |
| InChIKey | ZAGGLSYNGXHITO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|