C18H25NO2 — CID 60816084
N,N-dibutyl-4-(3-hydroxyprop-1-ynyl)benzamide (PubChem CID 60816084) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is N,N-dibutyl-4-(3-hydroxyprop-1-ynyl)benzamide.
| Compound Name | N,N-dibutyl-4-(3-hydroxyprop-1-ynyl)benzamide |
|---|---|
| PubChem CID | 60816084 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | N,N-dibutyl-4-(3-hydroxyprop-1-ynyl)benzamide |
| SMILES | CCCCN(CCCC)C(=O)c1ccc(C#CCO)cc1 |
| InChI | InChI=1S/C18H25NO2/c1-3-5-13-19(14-6-4-2)18(21)17-11-9-16(10-12-17)8-7-15-20/h9-12,20H,3-6,13-15H2,1-2H3 |
| InChIKey | GEFMJPSCOILOLC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|