C15H21NO4S — CID 61447827
N-butyl-N-(2-hydroxyethyl)-4-(3-hydroxyprop-1-ynyl)benzenesulfonamide (PubChem CID 61447827) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is N-butyl-N-(2-hydroxyethyl)-4-(3-hydroxyprop-1-ynyl)benzenesulfonamide.
| Compound Name | N-butyl-N-(2-hydroxyethyl)-4-(3-hydroxyprop-1-ynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61447827 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-butyl-N-(2-hydroxyethyl)-4-(3-hydroxyprop-1-ynyl)benzenesulfonamide |
| SMILES | CCCCN(CCO)S(=O)(=O)c1ccc(C#CCO)cc1 |
| InChI | InChI=1S/C15H21NO4S/c1-2-3-10-16(11-13-18)21(19,20)15-8-6-14(7-9-15)5-4-12-17/h6-9,17-18H,2-3,10-13H2,1H3 |
| InChIKey | MIWXEABRQKYLSA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|