C13H13FN2O3 — CID 60816589
N-(2-amino-2-oxoethyl)-5-fluoro-2-(4-hydroxybut-1-ynyl)benzamide (PubChem CID 60816589) has the molecular formula C13H13FN2O3 and a molecular weight of 264.26 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-5-fluoro-2-(4-hydroxybut-1-ynyl)benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-5-fluoro-2-(4-hydroxybut-1-ynyl)benzamide |
|---|---|
| PubChem CID | 60816589 |
| Molecular Formula | C13H13FN2O3 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-5-fluoro-2-(4-hydroxybut-1-ynyl)benzamide |
| SMILES | NC(=O)CNC(=O)c1cc(F)ccc1C#CCCO |
| InChI | InChI=1S/C13H13FN2O3/c14-10-5-4-9(3-1-2-6-17)11(7-10)13(19)16-8-12(15)18/h4-5,7,17H,2,6,8H2,(H2,15,18)(H,16,19) |
| InChIKey | NTEOEBMFOLLRQH-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|