C14H11FN2O2S — CID 60815649
5-fluoro-2-(4-hydroxybut-1-ynyl)-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 60815649) has the molecular formula C14H11FN2O2S and a molecular weight of 290.32 g/mol. Its IUPAC name is 5-fluoro-2-(4-hydroxybut-1-ynyl)-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 5-fluoro-2-(4-hydroxybut-1-ynyl)-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 60815649 |
| Molecular Formula | C14H11FN2O2S |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 5-fluoro-2-(4-hydroxybut-1-ynyl)-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1cc(F)ccc1C#CCCO |
| InChI | InChI=1S/C14H11FN2O2S/c15-11-5-4-10(3-1-2-7-18)12(9-11)13(19)17-14-16-6-8-20-14/h4-6,8-9,18H,2,7H2,(H,16,17,19) |
| InChIKey | JBFBXQLBCJIEMQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|