C15H13FN2O3 — CID 60817208
4-fluoro-2-(4-hydroxybut-1-ynyl)-N-(3-methyl-1,2-oxazol-5-yl)benzamide (PubChem CID 60817208) has the molecular formula C15H13FN2O3 and a molecular weight of 288.28 g/mol. Its IUPAC name is 4-fluoro-2-(4-hydroxybut-1-ynyl)-N-(3-methyl-1,2-oxazol-5-yl)benzamide.
| Compound Name | 4-fluoro-2-(4-hydroxybut-1-ynyl)-N-(3-methyl-1,2-oxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 60817208 |
| Molecular Formula | C15H13FN2O3 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-fluoro-2-(4-hydroxybut-1-ynyl)-N-(3-methyl-1,2-oxazol-5-yl)benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(F)cc2C#CCCO)on1 |
| InChI | InChI=1S/C15H13FN2O3/c1-10-8-14(21-18-10)17-15(20)13-6-5-12(16)9-11(13)4-2-3-7-19/h5-6,8-9,19H,3,7H2,1H3,(H,17,20) |
| InChIKey | KVWSXKKLHNQTML-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|