C17H19BrClN — CID 60819176
N-[2-(4-bromophenyl)-1-(3-chlorophenyl)ethyl]propan-1-amine (PubChem CID 60819176) has the molecular formula C17H19BrClN and a molecular weight of 352.70 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)-1-(3-chlorophenyl)ethyl]propan-1-amine.
| Compound Name | N-[2-(4-bromophenyl)-1-(3-chlorophenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 60819176 |
| Molecular Formula | C17H19BrClN |
| Molecular Weight | 352.70 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | N-[2-(4-bromophenyl)-1-(3-chlorophenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(Br)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H19BrClN/c1-2-10-20-17(14-4-3-5-16(19)12-14)11-13-6-8-15(18)9-7-13/h3-9,12,17,20H,2,10-11H2,1H3 |
| InChIKey | SUMCMLGLLISKOO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.70 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |