C16H17Br2N — CID 60819896
1-(3-bromophenyl)-2-(4-bromophenyl)-N-ethylethanamine (PubChem CID 60819896) has the molecular formula C16H17Br2N and a molecular weight of 383.13 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(4-bromophenyl)-N-ethylethanamine.
| Compound Name | 1-(3-bromophenyl)-2-(4-bromophenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 60819896 |
| Molecular Formula | C16H17Br2N |
| Molecular Weight | 383.13 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | 1-(3-bromophenyl)-2-(4-bromophenyl)-N-ethylethanamine |
| SMILES | CCNC(Cc1ccc(Br)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H17Br2N/c1-2-19-16(13-4-3-5-15(18)11-13)10-12-6-8-14(17)9-7-12/h3-9,11,16,19H,2,10H2,1H3 |
| InChIKey | OYLXQXMJEOUUOW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.13 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |