C17H20ClNO2 — CID 60819659
2-(3-chlorophenyl)-1-(3,4-dimethoxyphenyl)-N-methylethanamine (PubChem CID 60819659) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-(3,4-dimethoxyphenyl)-N-methylethanamine.
| Compound Name | 2-(3-chlorophenyl)-1-(3,4-dimethoxyphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 60819659 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-(3-chlorophenyl)-1-(3,4-dimethoxyphenyl)-N-methylethanamine |
| SMILES | CNC(Cc1cccc(Cl)c1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H20ClNO2/c1-19-15(10-12-5-4-6-14(18)9-12)13-7-8-16(20-2)17(11-13)21-3/h4-9,11,15,19H,10H2,1-3H3 |
| InChIKey | DWGSMHKMEKKYKR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |