C19H18ClN — CID 63412161
2-(3-chlorophenyl)-N-methyl-1-naphthalen-2-ylethanamine (PubChem CID 63412161) has the molecular formula C19H18ClN and a molecular weight of 295.81 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-methyl-1-naphthalen-2-ylethanamine.
| Compound Name | 2-(3-chlorophenyl)-N-methyl-1-naphthalen-2-ylethanamine |
|---|---|
| PubChem CID | 63412161 |
| Molecular Formula | C19H18ClN |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-(3-chlorophenyl)-N-methyl-1-naphthalen-2-ylethanamine |
| SMILES | CNC(Cc1cccc(Cl)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H18ClN/c1-21-19(12-14-5-4-8-18(20)11-14)17-10-9-15-6-2-3-7-16(15)13-17/h2-11,13,19,21H,12H2,1H3 |
| InChIKey | YPEZNZDNAOSIMD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |