C16H21NO3S — CID 60823033
4-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]but-3-yn-1-ol (PubChem CID 60823033) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is 4-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]but-3-yn-1-ol.
| Compound Name | 4-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 60823033 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]but-3-yn-1-ol |
| SMILES | CC1CCCN(S(=O)(=O)c2ccc(C#CCCO)cc2)C1 |
| InChI | InChI=1S/C16H21NO3S/c1-14-5-4-11-17(13-14)21(19,20)16-9-7-15(8-10-16)6-2-3-12-18/h7-10,14,18H,3-5,11-13H2,1H3 |
| InChIKey | DFFPDNIBXBDYPG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|