C11H18N2O2S — CID 60824654
N-ethyl-N-methyl-4-(methylaminomethyl)benzenesulfonamide (PubChem CID 60824654) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is N-ethyl-N-methyl-4-(methylaminomethyl)benzenesulfonamide.
| Compound Name | N-ethyl-N-methyl-4-(methylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60824654 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | N-ethyl-N-methyl-4-(methylaminomethyl)benzenesulfonamide |
| SMILES | CCN(C)S(=O)(=O)c1ccc(CNC)cc1 |
| InChI | InChI=1S/C11H18N2O2S/c1-4-13(3)16(14,15)11-7-5-10(6-8-11)9-12-2/h5-8,12H,4,9H2,1-3H3 |
| InChIKey | JUPWYAZTLRMXDO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |