C11H17NO2S — CID 142914245
N,4-diethyl-N-methylbenzenesulfonamide (PubChem CID 142914245) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is N,4-diethyl-N-methylbenzenesulfonamide.
| Compound Name | N,4-diethyl-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 142914245 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | N,4-diethyl-N-methylbenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)N(C)CC)cc1 |
| InChI | InChI=1S/C11H17NO2S/c1-4-10-6-8-11(9-7-10)15(13,14)12(3)5-2/h6-9H,4-5H2,1-3H3 |
| InChIKey | LTQLPABZTWJHGY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |