C16H23NO3S — CID 60824779
5-(3-hydroxyprop-1-ynyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)benzenesulfonamide (PubChem CID 60824779) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is 5-(3-hydroxyprop-1-ynyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)benzenesulfonamide.
| Compound Name | 5-(3-hydroxyprop-1-ynyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 60824779 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 5-(3-hydroxyprop-1-ynyl)-N,2-dimethyl-N-(3-methylbutan-2-yl)benzenesulfonamide |
| SMILES | Cc1ccc(C#CCO)cc1S(=O)(=O)N(C)C(C)C(C)C |
| InChI | InChI=1S/C16H23NO3S/c1-12(2)14(4)17(5)21(19,20)16-11-15(7-6-10-18)9-8-13(16)3/h8-9,11-12,14,18H,10H2,1-5H3 |
| InChIKey | VSNVMDDKVOQGSX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|