C14H18N2O4S — CID 103103904
2-[ethyl-[5-(3-hydroxyprop-1-ynyl)-2-methylphenyl]sulfonylamino]acetamide (PubChem CID 103103904) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-[ethyl-[5-(3-hydroxyprop-1-ynyl)-2-methylphenyl]sulfonylamino]acetamide.
| Compound Name | 2-[ethyl-[5-(3-hydroxyprop-1-ynyl)-2-methylphenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 103103904 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-[ethyl-[5-(3-hydroxyprop-1-ynyl)-2-methylphenyl]sulfonylamino]acetamide |
| SMILES | CCN(CC(N)=O)S(=O)(=O)c1cc(C#CCO)ccc1C |
| InChI | InChI=1S/C14H18N2O4S/c1-3-16(10-14(15)18)21(19,20)13-9-12(5-4-8-17)7-6-11(13)2/h6-7,9,17H,3,8,10H2,1-2H3,(H2,15,18) |
| InChIKey | WJOGGUTYUBQGPL-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|