C13H19N3O5 — CID 60825266
2-[cyclopentyl-[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]acetic acid (PubChem CID 60825266) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[cyclopentyl-[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]acetic acid.
| Compound Name | 2-[cyclopentyl-[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 60825266 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[cyclopentyl-[2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]acetic acid |
| SMILES | CN1CC(=O)N(CC(=O)N(CC(=O)O)C2CCCC2)C1=O |
| InChI | InChI=1S/C13H19N3O5/c1-14-6-10(17)16(13(14)21)7-11(18)15(8-12(19)20)9-4-2-3-5-9/h9H,2-8H2,1H3,(H,19,20) |
| InChIKey | RWVXPIJGTVPOLT-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|