4-[(3,4-difluorobenzoyl)-propan-2-ylamino]butanoic acid

C14H17F2NO3 — CID 60826122

IUPAC4-[(3,4-difluorobenzoyl)-propan-2-ylamino]butanoic acid
SMILESCC(C)N(CCCC(=O)O)C(=O)c1ccc(F)c(F)c1
InChIInChI=1S/C14H17F2NO3/c1-9(2)17(7-3-4-13(18)19)14(20)10-5-6-11(15)12(16)8-10/h5-6,8-9H,3-4,7H2,1-2H3,(H,18,19)
InChIKeyMJKLBJGFWWBMFX-UHFFFAOYSA-N
MW285.29 g/mol
LogP2.68
Rot. Bonds6

About 4-[(3,4-difluorobenzoyl)-propan-2-ylamino]butanoic acid

4-[(3,4-difluorobenzoyl)-propan-2-ylamino]butanoic acid (PubChem CID 60826122) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is 4-[(3,4-difluorobenzoyl)-propan-2-ylamino]butanoic acid.

Molecular Properties

Compound Name4-[(3,4-difluorobenzoyl)-propan-2-ylamino]butanoic acid
PubChem CID60826122
Molecular FormulaC14H17F2NO3
Molecular Weight285.29 g/mol
Exact Mass285.12
IUPAC Name4-[(3,4-difluorobenzoyl)-propan-2-ylamino]butanoic acid
SMILESCC(C)N(CCCC(=O)O)C(=O)c1ccc(F)c(F)c1
InChIInChI=1S/C14H17F2NO3/c1-9(2)17(7-3-4-13(18)19)14(20)10-5-6-11(15)12(16)8-10/h5-6,8-9H,3-4,7H2,1-2H3,(H,18,19)
InChIKeyMJKLBJGFWWBMFX-UHFFFAOYSA-N
XLogP2.68
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.29
LogP ≤ 52.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-[(3,4-difluorobenzoyl)-propan-2-ylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(3,4-difluorobenzoyl)-propan-2-ylamino]butanoic acid?
The IUPAC name of 4-[(3,4-difluorobenzoyl)-propan-2-ylamino]butanoic acid (CID 60826122) is 4-[(3,4-difluorobenzoyl)-propan-2-ylamino]butanoic acid.
What is the SMILES notation for 4-[(3,4-difluorobenzoyl)-propan-2-ylamino]butanoic acid?
The canonical SMILES for 4-[(3,4-difluorobenzoyl)-propan-2-ylamino]butanoic acid is CC(C)N(CCCC(=O)O)C(=O)c1ccc(F)c(F)c1.
What is the InChIKey of 4-[(3,4-difluorobenzoyl)-propan-2-ylamino]butanoic acid?
The InChIKey is MJKLBJGFWWBMFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2NO3/c1-9(2)17(7-3-4-13(18)19)14(20)10-5-6-11(15)12(16)8-10/h5-6,8-9H,3-4,7H2,1-2H3,(H,18,19).
What are the key properties of 4-[(3,4-difluorobenzoyl)-propan-2-ylamino]butanoic acid?
4-[(3,4-difluorobenzoyl)-propan-2-ylamino]butanoic acid has a molecular weight of 285.29 g/mol, XLogP of 2.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-difluorobenzoyl)-propan-2-ylamino]butanoic acid is sourced from PubChem (CID 60826122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).