C14H17ClFNO3 — CID 60830756
4-[(2-chloro-4-fluorobenzoyl)-propan-2-ylamino]butanoic acid (PubChem CID 60830756) has the molecular formula C14H17ClFNO3 and a molecular weight of 301.74 g/mol. Its IUPAC name is 4-[(2-chloro-4-fluorobenzoyl)-propan-2-ylamino]butanoic acid.
| Compound Name | 4-[(2-chloro-4-fluorobenzoyl)-propan-2-ylamino]butanoic acid |
|---|---|
| PubChem CID | 60830756 |
| Molecular Formula | C14H17ClFNO3 |
| Molecular Weight | 301.74 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 4-[(2-chloro-4-fluorobenzoyl)-propan-2-ylamino]butanoic acid |
| SMILES | CC(C)N(CCCC(=O)O)C(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H17ClFNO3/c1-9(2)17(7-3-4-13(18)19)14(20)11-6-5-10(16)8-12(11)15/h5-6,8-9H,3-4,7H2,1-2H3,(H,18,19) |
| InChIKey | LLVWSAWXKVZZRW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.74 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |