C19H19F2NO3 — CID 119206988
3-[[2-fluoro-4-(4-fluorophenyl)benzoyl]-propan-2-ylamino]propanoic acid (PubChem CID 119206988) has the molecular formula C19H19F2NO3 and a molecular weight of 347.36 g/mol. Its IUPAC name is 3-[[2-fluoro-4-(4-fluorophenyl)benzoyl]-propan-2-ylamino]propanoic acid.
| Compound Name | 3-[[2-fluoro-4-(4-fluorophenyl)benzoyl]-propan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 119206988 |
| Molecular Formula | C19H19F2NO3 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 3-[[2-fluoro-4-(4-fluorophenyl)benzoyl]-propan-2-ylamino]propanoic acid |
| SMILES | CC(C)N(CCC(=O)O)C(=O)c1ccc(-c2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C19H19F2NO3/c1-12(2)22(10-9-18(23)24)19(25)16-8-5-14(11-17(16)21)13-3-6-15(20)7-4-13/h3-8,11-12H,9-10H2,1-2H3,(H,23,24) |
| InChIKey | XVIZUDNLCHZBGU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |