C15H14ClNO3S — CID 60830591
3-(N-(5-chlorothiophene-2-carbonyl)-4-methylanilino)propanoic acid (PubChem CID 60830591) has the molecular formula C15H14ClNO3S and a molecular weight of 323.80 g/mol. Its IUPAC name is 3-(N-(5-chlorothiophene-2-carbonyl)-4-methylanilino)propanoic acid.
| Compound Name | 3-(N-(5-chlorothiophene-2-carbonyl)-4-methylanilino)propanoic acid |
|---|---|
| PubChem CID | 60830591 |
| Molecular Formula | C15H14ClNO3S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 3-(N-(5-chlorothiophene-2-carbonyl)-4-methylanilino)propanoic acid |
| SMILES | Cc1ccc(N(CCC(=O)O)C(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C15H14ClNO3S/c1-10-2-4-11(5-3-10)17(9-8-14(18)19)15(20)12-6-7-13(16)21-12/h2-7H,8-9H2,1H3,(H,18,19) |
| InChIKey | VNCAKNQPMSKQNG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |