C11H12ClNO3S — CID 60845442
3-[(5-chlorothiophene-2-carbonyl)-cyclopropylamino]propanoic acid (PubChem CID 60845442) has the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. Its IUPAC name is 3-[(5-chlorothiophene-2-carbonyl)-cyclopropylamino]propanoic acid.
| Compound Name | 3-[(5-chlorothiophene-2-carbonyl)-cyclopropylamino]propanoic acid |
|---|---|
| PubChem CID | 60845442 |
| Molecular Formula | C11H12ClNO3S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 3-[(5-chlorothiophene-2-carbonyl)-cyclopropylamino]propanoic acid |
| SMILES | O=C(O)CCN(C(=O)c1ccc(Cl)s1)C1CC1 |
| InChI | InChI=1S/C11H12ClNO3S/c12-9-4-3-8(17-9)11(16)13(7-1-2-7)6-5-10(14)15/h3-4,7H,1-2,5-6H2,(H,14,15) |
| InChIKey | SWMWNAMQMFCBPV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |