C14H17NO5S — CID 60830600
2-(N-(1,1-dioxothiolane-3-carbonyl)-4-methylanilino)acetic acid (PubChem CID 60830600) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is 2-(N-(1,1-dioxothiolane-3-carbonyl)-4-methylanilino)acetic acid.
| Compound Name | 2-(N-(1,1-dioxothiolane-3-carbonyl)-4-methylanilino)acetic acid |
|---|---|
| PubChem CID | 60830600 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2-(N-(1,1-dioxothiolane-3-carbonyl)-4-methylanilino)acetic acid |
| SMILES | Cc1ccc(N(CC(=O)O)C(=O)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C14H17NO5S/c1-10-2-4-12(5-3-10)15(8-13(16)17)14(18)11-6-7-21(19,20)9-11/h2-5,11H,6-9H2,1H3,(H,16,17) |
| InChIKey | APYPAIBBZIMGGG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |