2-(N-(4,5-dimethylthiophene-2-carbonyl)anilino)acetic acid

C15H15NO3S — CID 60831160

IUPAC2-(N-(4,5-dimethylthiophene-2-carbonyl)anilino)acetic acid
SMILESCc1cc(C(=O)N(CC(=O)O)c2ccccc2)sc1C
InChIInChI=1S/C15H15NO3S/c1-10-8-13(20-11(10)2)15(19)16(9-14(17)18)12-6-4-3-5-7-12/h3-8H,9H2,1-2H3,(H,17,18)
InChIKeyVMZPMEDZRZTDQX-UHFFFAOYSA-N
MW289.36 g/mol
LogP3.10
Rot. Bonds4

About 2-(N-(4,5-dimethylthiophene-2-carbonyl)anilino)acetic acid

2-(N-(4,5-dimethylthiophene-2-carbonyl)anilino)acetic acid (PubChem CID 60831160) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is 2-(N-(4,5-dimethylthiophene-2-carbonyl)anilino)acetic acid.

Molecular Properties

Compound Name2-(N-(4,5-dimethylthiophene-2-carbonyl)anilino)acetic acid
PubChem CID60831160
Molecular FormulaC15H15NO3S
Molecular Weight289.36 g/mol
Exact Mass289.08
IUPAC Name2-(N-(4,5-dimethylthiophene-2-carbonyl)anilino)acetic acid
SMILESCc1cc(C(=O)N(CC(=O)O)c2ccccc2)sc1C
InChIInChI=1S/C15H15NO3S/c1-10-8-13(20-11(10)2)15(19)16(9-14(17)18)12-6-4-3-5-7-12/h3-8H,9H2,1-2H3,(H,17,18)
InChIKeyVMZPMEDZRZTDQX-UHFFFAOYSA-N
XLogP3.10
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.36
LogP ≤ 53.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(N-(4,5-dimethylthiophene-2-carbonyl)anilino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(N-(4,5-dimethylthiophene-2-carbonyl)anilino)acetic acid?
The IUPAC name of 2-(N-(4,5-dimethylthiophene-2-carbonyl)anilino)acetic acid (CID 60831160) is 2-(N-(4,5-dimethylthiophene-2-carbonyl)anilino)acetic acid.
What is the SMILES notation for 2-(N-(4,5-dimethylthiophene-2-carbonyl)anilino)acetic acid?
The canonical SMILES for 2-(N-(4,5-dimethylthiophene-2-carbonyl)anilino)acetic acid is Cc1cc(C(=O)N(CC(=O)O)c2ccccc2)sc1C.
What is the InChIKey of 2-(N-(4,5-dimethylthiophene-2-carbonyl)anilino)acetic acid?
The InChIKey is VMZPMEDZRZTDQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO3S/c1-10-8-13(20-11(10)2)15(19)16(9-14(17)18)12-6-4-3-5-7-12/h3-8H,9H2,1-2H3,(H,17,18).
What are the key properties of 2-(N-(4,5-dimethylthiophene-2-carbonyl)anilino)acetic acid?
2-(N-(4,5-dimethylthiophene-2-carbonyl)anilino)acetic acid has a molecular weight of 289.36 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N-(4,5-dimethylthiophene-2-carbonyl)anilino)acetic acid is sourced from PubChem (CID 60831160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).