C14H13BrN2O4 — CID 60831427
4-[(4-bromo-1H-pyrrole-2-carbonyl)-(2-hydroxyethyl)amino]benzoic acid (PubChem CID 60831427) has the molecular formula C14H13BrN2O4 and a molecular weight of 353.17 g/mol. Its IUPAC name is 4-[(4-bromo-1H-pyrrole-2-carbonyl)-(2-hydroxyethyl)amino]benzoic acid.
| Compound Name | 4-[(4-bromo-1H-pyrrole-2-carbonyl)-(2-hydroxyethyl)amino]benzoic acid |
|---|---|
| PubChem CID | 60831427 |
| Molecular Formula | C14H13BrN2O4 |
| Molecular Weight | 353.17 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 4-[(4-bromo-1H-pyrrole-2-carbonyl)-(2-hydroxyethyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(N(CCO)C(=O)c2cc(Br)c[nH]2)cc1 |
| InChI | InChI=1S/C14H13BrN2O4/c15-10-7-12(16-8-10)13(19)17(5-6-18)11-3-1-9(2-4-11)14(20)21/h1-4,7-8,16,18H,5-6H2,(H,20,21) |
| InChIKey | JKNYENLQJBZHMY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.17 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |