3-[cyclopropyl(2-ethoxyethyl)amino]propanoic acid

C10H19NO3 — CID 60838703

IUPAC3-[cyclopropyl(2-ethoxyethyl)amino]propanoic acid
SMILESCCOCCN(CCC(=O)O)C1CC1
InChIInChI=1S/C10H19NO3/c1-2-14-8-7-11(9-3-4-9)6-5-10(12)13/h9H,2-8H2,1H3,(H,12,13)
InChIKeyKACPOUSRBPYIDO-UHFFFAOYSA-N
MW201.27 g/mol
LogP0.96
Rot. Bonds8

About 3-[cyclopropyl(2-ethoxyethyl)amino]propanoic acid

3-[cyclopropyl(2-ethoxyethyl)amino]propanoic acid (PubChem CID 60838703) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-[cyclopropyl(2-ethoxyethyl)amino]propanoic acid.

Molecular Properties

Compound Name3-[cyclopropyl(2-ethoxyethyl)amino]propanoic acid
PubChem CID60838703
Molecular FormulaC10H19NO3
Molecular Weight201.27 g/mol
Exact Mass201.14
IUPAC Name3-[cyclopropyl(2-ethoxyethyl)amino]propanoic acid
SMILESCCOCCN(CCC(=O)O)C1CC1
InChIInChI=1S/C10H19NO3/c1-2-14-8-7-11(9-3-4-9)6-5-10(12)13/h9H,2-8H2,1H3,(H,12,13)
InChIKeyKACPOUSRBPYIDO-UHFFFAOYSA-N
XLogP0.96
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.27
LogP ≤ 50.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-[cyclopropyl(2-ethoxyethyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-[2-[cyclopropyl(ethyl)amino]ethoxy]propanoic acid
CID 169177393
3-[2-ethoxyethyl(methyl)amino]propanoic acid
CID 60988072
3-[cyclopropyl(dodecyl)amino]propanoic acid
CID 62065004
3-[cyclopropyl(3-methylbutyl)amino]propanoic acid
CID 60839527
3-[(4-aminocyclohexyl)-ethylamino]propanoic acid
CID 79115702
2-[2-[2-(2-butoxyethoxy)ethoxy]ethyl-cyclopropylamino]acetic acid
CID 104564790
3-[cyclopropyl(3-ethoxypropyl)amino]propanethioamide
CID 65175458
3-[cyclopropyl-(2-propoxyacetyl)amino]propanoic acid
CID 115730536
3-[cyclopropyl-(2-ethyl-2-hydroxybutyl)amino]propanoic acid
CID 114494787
3-[3-ethoxypropyl(ethyl)amino]propanoic acid
CID 65180873
3-[cyclopropyl(4-methylsulfanylbutyl)amino]propanoic acid
CID 103090410
4-[2-ethoxyethyl(ethyl)amino]cyclohexan-1-one
CID 114762224

Frequently Asked Questions

What is the IUPAC name of 3-[cyclopropyl(2-ethoxyethyl)amino]propanoic acid?
The IUPAC name of 3-[cyclopropyl(2-ethoxyethyl)amino]propanoic acid (CID 60838703) is 3-[cyclopropyl(2-ethoxyethyl)amino]propanoic acid.
What is the SMILES notation for 3-[cyclopropyl(2-ethoxyethyl)amino]propanoic acid?
The canonical SMILES for 3-[cyclopropyl(2-ethoxyethyl)amino]propanoic acid is CCOCCN(CCC(=O)O)C1CC1.
What is the InChIKey of 3-[cyclopropyl(2-ethoxyethyl)amino]propanoic acid?
The InChIKey is KACPOUSRBPYIDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-2-14-8-7-11(9-3-4-9)6-5-10(12)13/h9H,2-8H2,1H3,(H,12,13).
What are the key properties of 3-[cyclopropyl(2-ethoxyethyl)amino]propanoic acid?
3-[cyclopropyl(2-ethoxyethyl)amino]propanoic acid has a molecular weight of 201.27 g/mol, XLogP of 0.96, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[cyclopropyl(2-ethoxyethyl)amino]propanoic acid is sourced from PubChem (CID 60838703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).