3-[cyclopropyl-[(3,5-dimethylphenyl)methyl]amino]propanoic acid

C15H21NO2 — CID 60839372

IUPAC3-[cyclopropyl-[(3,5-dimethylphenyl)methyl]amino]propanoic acid
SMILESCc1cc(C)cc(CN(CCC(=O)O)C2CC2)c1
InChIInChI=1S/C15H21NO2/c1-11-7-12(2)9-13(8-11)10-16(14-3-4-14)6-5-15(17)18/h7-9,14H,3-6,10H2,1-2H3,(H,17,18)
InChIKeyXSTLLKUVXZSKOC-UHFFFAOYSA-N
MW247.34 g/mol
LogP2.74
Rot. Bonds6

About 3-[cyclopropyl-[(3,5-dimethylphenyl)methyl]amino]propanoic acid

3-[cyclopropyl-[(3,5-dimethylphenyl)methyl]amino]propanoic acid (PubChem CID 60839372) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 3-[cyclopropyl-[(3,5-dimethylphenyl)methyl]amino]propanoic acid.

Molecular Properties

Compound Name3-[cyclopropyl-[(3,5-dimethylphenyl)methyl]amino]propanoic acid
PubChem CID60839372
Molecular FormulaC15H21NO2
Molecular Weight247.34 g/mol
Exact Mass247.16
IUPAC Name3-[cyclopropyl-[(3,5-dimethylphenyl)methyl]amino]propanoic acid
SMILESCc1cc(C)cc(CN(CCC(=O)O)C2CC2)c1
InChIInChI=1S/C15H21NO2/c1-11-7-12(2)9-13(8-11)10-16(14-3-4-14)6-5-15(17)18/h7-9,14H,3-6,10H2,1-2H3,(H,17,18)
InChIKeyXSTLLKUVXZSKOC-UHFFFAOYSA-N
XLogP2.74
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.34
LogP ≤ 52.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-[cyclopropyl-[(3,5-dimethylphenyl)methyl]amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[cyclopropyl-[(3,5-dimethylphenyl)methyl]amino]propanoic acid?
The IUPAC name of 3-[cyclopropyl-[(3,5-dimethylphenyl)methyl]amino]propanoic acid (CID 60839372) is 3-[cyclopropyl-[(3,5-dimethylphenyl)methyl]amino]propanoic acid.
What is the SMILES notation for 3-[cyclopropyl-[(3,5-dimethylphenyl)methyl]amino]propanoic acid?
The canonical SMILES for 3-[cyclopropyl-[(3,5-dimethylphenyl)methyl]amino]propanoic acid is Cc1cc(C)cc(CN(CCC(=O)O)C2CC2)c1.
What is the InChIKey of 3-[cyclopropyl-[(3,5-dimethylphenyl)methyl]amino]propanoic acid?
The InChIKey is XSTLLKUVXZSKOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-11-7-12(2)9-13(8-11)10-16(14-3-4-14)6-5-15(17)18/h7-9,14H,3-6,10H2,1-2H3,(H,17,18).
What are the key properties of 3-[cyclopropyl-[(3,5-dimethylphenyl)methyl]amino]propanoic acid?
3-[cyclopropyl-[(3,5-dimethylphenyl)methyl]amino]propanoic acid has a molecular weight of 247.34 g/mol, XLogP of 2.74, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[cyclopropyl-[(3,5-dimethylphenyl)methyl]amino]propanoic acid is sourced from PubChem (CID 60839372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).